Buyer interested in

view more

laxogenin

CAS: 1177-71-5 MF:C27H42O4 MW:430.63 InChI:InChI=1/C27H42O4/c1-15-5-10-27(30-14-15)16(2)24-23(31-27) 13-20-18-12-22(29)21-11-